C15H20Cl3N2+ — CID 101091582
(3S)-3,5,5-trimethyl-3-propan-2-yl-1-(2,4,6-trichlorophenyl)-4H-pyrazol-1-ium (PubChem CID 101091582) has the molecular formula C15H20Cl3N2+ and a molecular weight of 334.70 g/mol. Its IUPAC name is (3S)-3,5,5-trimethyl-3-propan-2-yl-1-(2,4,6-trichlorophenyl)-4H-pyrazol-1-ium.
| Compound Name | (3S)-3,5,5-trimethyl-3-propan-2-yl-1-(2,4,6-trichlorophenyl)-4H-pyrazol-1-ium |
|---|---|
| PubChem CID | 101091582 |
| Molecular Formula | C15H20Cl3N2+ |
| Molecular Weight | 334.70 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | (3S)-3,5,5-trimethyl-3-propan-2-yl-1-(2,4,6-trichlorophenyl)-4H-pyrazol-1-ium |
| SMILES | CC(C)[C@]1(C)CC(C)(C)[N+](c2c(Cl)cc(Cl)cc2Cl)=N1 |
| InChI | InChI=1S/C15H20Cl3N2/c1-9(2)15(5)8-14(3,4)20(19-15)13-11(17)6-10(16)7-12(13)18/h6-7,9H,8H2,1-5H3/q+1/t15-/m0/s1 |
| InChIKey | HUOJPDLETVKFRJ-HNNXBMFYSA-N |
| XLogP | 6.34 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.70 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|