C19H21FN2O2S — CID 10109176
(5aS,10bS)-9-(4-fluorophenyl)sulfonyl-3-methyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole (PubChem CID 10109176) has the molecular formula C19H21FN2O2S and a molecular weight of 360.45 g/mol. Its IUPAC name is (5aS,10bS)-9-(4-fluorophenyl)sulfonyl-3-methyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole.
| Compound Name | (5aS,10bS)-9-(4-fluorophenyl)sulfonyl-3-methyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 10109176 |
| Molecular Formula | C19H21FN2O2S |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | (5aS,10bS)-9-(4-fluorophenyl)sulfonyl-3-methyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole |
| SMILES | CN1CC[C@@H]2Nc3ccc(S(=O)(=O)c4ccc(F)cc4)cc3[C@@H]2CC1 |
| InChI | InChI=1S/C19H21FN2O2S/c1-22-10-8-16-17-12-15(6-7-18(17)21-19(16)9-11-22)25(23,24)14-4-2-13(20)3-5-14/h2-7,12,16,19,21H,8-11H2,1H3/t16-,19-/m0/s1 |
| InChIKey | WZMFDKHGHZLVIU-LPHOPBHVSA-N |
| XLogP | 3.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |