C16H12O5 — CID 101092239
9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,8-diol (PubChem CID 101092239) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is 9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,8-diol.
| Compound Name | 9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,8-diol |
|---|---|
| PubChem CID | 101092239 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 9-methoxy-6H-[1]benzofuro[3,2-c]chromene-3,8-diol |
| SMILES | COc1cc2oc3c(c2cc1O)COc1cc(O)ccc1-3 |
| InChI | InChI=1S/C16H12O5/c1-19-15-6-14-10(5-12(15)18)11-7-20-13-4-8(17)2-3-9(13)16(11)21-14/h2-6,17-18H,7H2,1H3 |
| InChIKey | CZJSVJBVSXTTCY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |