About 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide
8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide (PubChem CID 10109248) has the molecular formula C20H24ClNO3
and a molecular weight of 361.87 g/mol. Its IUPAC name is 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide.
Molecular Properties
| Compound Name | 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide |
| PubChem CID | 10109248 |
| Molecular Formula | C20H24ClNO3 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide |
| SMILES | O=C(CCCCCCC(O)c1ccc(-c2ccc(Cl)cc2)cc1)NO |
| InChI | InChI=1S/C20H24ClNO3/c21-18-13-11-16(12-14-18)15-7-9-17(10-8-15)19(23)5-3-1-2-4-6-20(24)22-25/h7-14,19,23,25H,1-6H2,(H,22,24) |
| InChIKey | KKIRKMOUGXARQA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide?
The IUPAC name of 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide (CID 10109248) is 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide.
What is the SMILES notation for 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide?
The canonical SMILES for 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide is O=C(CCCCCCC(O)c1ccc(-c2ccc(Cl)cc2)cc1)NO.
What is the InChIKey of 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide?
The InChIKey is KKIRKMOUGXARQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24ClNO3/c21-18-13-11-16(12-14-18)15-7-9-17(10-8-15)19(23)5-3-1-2-4-6-20(24)22-25/h7-14,19,23,25H,1-6H2,(H,22,24).
What are the key properties of 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide?
8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide has a molecular weight of 361.87 g/mol, XLogP of 4.89, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[4-(4-chlorophenyl)phenyl]-N,8-dihydroxyoctanamide is sourced from PubChem (CID 10109248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).