C40H38N2O6S3 — CID 101093914
(3S,4R,5R,6S)-1,1-dioxo-3,6-bis(phenoxymethyl)-2,7-bis[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol (PubChem CID 101093914) has the molecular formula C40H38N2O6S3 and a molecular weight of 738.95 g/mol. Its IUPAC name is (3S,4R,5R,6S)-1,1-dioxo-3,6-bis(phenoxymethyl)-2,7-bis[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol.
| Compound Name | (3S,4R,5R,6S)-1,1-dioxo-3,6-bis(phenoxymethyl)-2,7-bis[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol |
|---|---|
| PubChem CID | 101093914 |
| Molecular Formula | C40H38N2O6S3 |
| Molecular Weight | 738.95 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | (3S,4R,5R,6S)-1,1-dioxo-3,6-bis(phenoxymethyl)-2,7-bis[(3-thiophen-2-ylphenyl)methyl]-1,2,7-thiadiazepane-4,5-diol |
| SMILES | O=S1(=O)N(Cc2cccc(-c3cccs3)c2)[C@@H](COc2ccccc2)[C@@H](O)[C@H](O)[C@H](COc2ccccc2)N1Cc1cccc(-c2cccs2)c1 |
| InChI | InChI=1S/C40H38N2O6S3/c43-39-35(27-47-33-15-3-1-4-16-33)41(25-29-11-7-13-31(23-29)37-19-9-21-49-37)51(45,46)42(36(40(39)44)28-48-34-17-5-2-6-18-34)26-30-12-8-14-32(24-30)38-20-10-22-50-38/h1-24,35-36,39-40,43-44H,25-28H2/t35-,36-,39+,40+/m0/s1 |
| InChIKey | BFCBBDDJOYSCOW-JEGXQRANSA-N |
| XLogP | 7.32 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.95 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |