C17H19FN2O4S — CID 10109470
(2S,4R)-2-amino-4-(3-fluorophenyl)-4-(4-methoxy-2-nitrophenyl)sulfanylbutan-1-ol (PubChem CID 10109470) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is (2S,4R)-2-amino-4-(3-fluorophenyl)-4-(4-methoxy-2-nitrophenyl)sulfanylbutan-1-ol.
| Compound Name | (2S,4R)-2-amino-4-(3-fluorophenyl)-4-(4-methoxy-2-nitrophenyl)sulfanylbutan-1-ol |
|---|---|
| PubChem CID | 10109470 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (2S,4R)-2-amino-4-(3-fluorophenyl)-4-(4-methoxy-2-nitrophenyl)sulfanylbutan-1-ol |
| SMILES | COc1ccc(S[C@H](C[C@H](N)CO)c2cccc(F)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19FN2O4S/c1-24-14-5-6-16(15(9-14)20(22)23)25-17(8-13(19)10-21)11-3-2-4-12(18)7-11/h2-7,9,13,17,21H,8,10,19H2,1H3/t13-,17+/m0/s1 |
| InChIKey | KDJUOQYMKSOFLS-SUMWQHHRSA-N |
| XLogP | 3.29 |
| TPSA | 98.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|