About ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate
ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate (PubChem CID 10109471) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate |
| PubChem CID | 10109471 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc3[nH]cc(C)c3c2)c(C)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-5-26-21(25)20(24)23-15-8-12(2)19(13(3)9-15)27-16-6-7-18-17(10-16)14(4)11-22-18/h6-11,22H,5H2,1-4H3,(H,23,24) |
| InChIKey | RWEKLGLVVRRTRA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate?
The IUPAC name of ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate (CID 10109471) is ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate.
What is the SMILES notation for ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate?
The canonical SMILES for ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate is CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc3[nH]cc(C)c3c2)c(C)c1.
What is the InChIKey of ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate?
The InChIKey is RWEKLGLVVRRTRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-5-26-21(25)20(24)23-15-8-12(2)19(13(3)9-15)27-16-6-7-18-17(10-16)14(4)11-22-18/h6-11,22H,5H2,1-4H3,(H,23,24).
What are the key properties of ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate?
ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate has a molecular weight of 366.42 g/mol, XLogP of 4.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[3,5-dimethyl-4-[(3-methyl-1H-indol-5-yl)oxy]anilino]-2-oxoacetate is sourced from PubChem (CID 10109471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).