C14H9F7N2O2 — CID 101094862
5-[2,2,3,3,4,4,4-heptafluoro-1-(5-formyl-1H-pyrrol-2-yl)butyl]-1H-pyrrole-2-carbaldehyde (PubChem CID 101094862) has the molecular formula C14H9F7N2O2 and a molecular weight of 370.22 g/mol. Its IUPAC name is 5-[2,2,3,3,4,4,4-heptafluoro-1-(5-formyl-1H-pyrrol-2-yl)butyl]-1H-pyrrole-2-carbaldehyde.
| Compound Name | 5-[2,2,3,3,4,4,4-heptafluoro-1-(5-formyl-1H-pyrrol-2-yl)butyl]-1H-pyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 101094862 |
| Molecular Formula | C14H9F7N2O2 |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | 5-[2,2,3,3,4,4,4-heptafluoro-1-(5-formyl-1H-pyrrol-2-yl)butyl]-1H-pyrrole-2-carbaldehyde |
| SMILES | O=Cc1ccc(C(c2ccc(C=O)[nH]2)C(F)(F)C(F)(F)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C14H9F7N2O2/c15-12(16,13(17,18)14(19,20)21)11(9-3-1-7(5-24)22-9)10-4-2-8(6-25)23-10/h1-6,11,22-23H |
| InChIKey | MBEHVNRKBIILET-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|