C20H28N6 — CID 101095352
3-[(1E,3E)-4-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)buta-1,3-dienyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole (PubChem CID 101095352) has the molecular formula C20H28N6 and a molecular weight of 352.49 g/mol. Its IUPAC name is 3-[(1E,3E)-4-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)buta-1,3-dienyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole.
| Compound Name | 3-[(1E,3E)-4-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)buta-1,3-dienyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
|---|---|
| PubChem CID | 101095352 |
| Molecular Formula | C20H28N6 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | 3-[(1E,3E)-4-(4,5,6,7,8,9-hexahydrocycloocta[d]triazol-3-yl)buta-1,3-dienyl]-4,5,6,7,8,9-hexahydrocycloocta[d]triazole |
| SMILES | C(/C=C/n1nnc2c1CCCCCC2)=C\n1nnc2c1CCCCCC2 |
| InChI | InChI=1S/C20H28N6/c1-3-7-13-19-17(11-5-1)21-23-25(19)15-9-10-16-26-20-14-8-4-2-6-12-18(20)22-24-26/h9-10,15-16H,1-8,11-14H2/b15-9+,16-10+ |
| InChIKey | DPGDDVNESHIOJK-KAVGSWPWSA-N |
| XLogP | 3.83 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|