About 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one
1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one (PubChem CID 101095382) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one.
Molecular Properties
| Compound Name | 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one |
| PubChem CID | 101095382 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one |
| SMILES | C=C/C=C/C1(C(=O)C(C)(C)C)N2CCCCC21C |
| InChI | InChI=1S/C16H25NO/c1-6-7-11-16(13(18)14(2,3)4)15(5)10-8-9-12-17(15)16/h6-7,11H,1,8-10,12H2,2-5H3/b11-7+ |
| InChIKey | CGPLXJQNAWVWKX-YRNVUSSQSA-N |
| XLogP | 3.34 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one?
The IUPAC name of 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one (CID 101095382) is 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one.
What is the SMILES notation for 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one?
The canonical SMILES for 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one is C=C/C=C/C1(C(=O)C(C)(C)C)N2CCCCC21C.
What is the InChIKey of 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one?
The InChIKey is CGPLXJQNAWVWKX-YRNVUSSQSA-N. The full InChI is InChI=1S/C16H25NO/c1-6-7-11-16(13(18)14(2,3)4)15(5)10-8-9-12-17(15)16/h6-7,11H,1,8-10,12H2,2-5H3/b11-7+.
What are the key properties of 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one?
1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one has a molecular weight of 247.38 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[7-[(1E)-buta-1,3-dienyl]-6-methyl-1-azabicyclo[4.1.0]heptan-7-yl]-2,2-dimethylpropan-1-one is sourced from PubChem (CID 101095382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).