About N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide
N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide (PubChem CID 101095460) has the molecular formula C8H6N2O5
and a molecular weight of 210.15 g/mol. Its IUPAC name is N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
| PubChem CID | 101095460 |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(=O)C([N+](=O)[O-])=CC1=O |
| InChI | InChI=1S/C8H6N2O5/c1-4(11)9-5-2-8(13)6(10(14)15)3-7(5)12/h2-3H,1H3,(H,9,11) |
| InChIKey | LZNDUQROCDVTRI-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
The IUPAC name of N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide (CID 101095460) is N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide.
What is the SMILES notation for N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
The canonical SMILES for N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide is CC(=O)NC1=CC(=O)C([N+](=O)[O-])=CC1=O.
What is the InChIKey of N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
The InChIKey is LZNDUQROCDVTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O5/c1-4(11)9-5-2-8(13)6(10(14)15)3-7(5)12/h2-3H,1H3,(H,9,11).
What are the key properties of N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide?
N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide has a molecular weight of 210.15 g/mol, XLogP of -0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-nitro-3,6-dioxocyclohexa-1,4-dien-1-yl)acetamide is sourced from PubChem (CID 101095460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).