C11H15O2- — CID 101095684
(1S,2R,4R)-2-ethenyl-1-methoxybicyclo[2.2.2]oct-5-en-2-olate (PubChem CID 101095684) has the molecular formula C11H15O2- and a molecular weight of 179.24 g/mol. Its IUPAC name is (1S,2R,4R)-2-ethenyl-1-methoxybicyclo[2.2.2]oct-5-en-2-olate.
| Compound Name | (1S,2R,4R)-2-ethenyl-1-methoxybicyclo[2.2.2]oct-5-en-2-olate |
|---|---|
| PubChem CID | 101095684 |
| Molecular Formula | C11H15O2- |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (1S,2R,4R)-2-ethenyl-1-methoxybicyclo[2.2.2]oct-5-en-2-olate |
| SMILES | C=C[C@]1([O-])C[C@@H]2C=C[C@@]1(OC)CC2 |
| InChI | InChI=1S/C11H15O2/c1-3-10(12)8-9-4-6-11(10,13-2)7-5-9/h3-4,6,9H,1,5,7-8H2,2H3/q-1/t9-,10+,11-/m1/s1 |
| InChIKey | CIXMBAWWYAJNND-OUAUKWLOSA-N |
| XLogP | 1.03 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|