About ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate
ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate (PubChem CID 101096071) has the molecular formula C23H34O5
and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate |
| PubChem CID | 101096071 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate |
| SMILES | CCOC(=O)[C@@H](CCC=C(C)C)[C@@H]1CC[C@H](OCc2ccc(OC)cc2)CO1 |
| InChI | InChI=1S/C23H34O5/c1-5-26-23(24)21(8-6-7-17(2)3)22-14-13-20(16-28-22)27-15-18-9-11-19(25-4)12-10-18/h7,9-12,20-22H,5-6,8,13-16H2,1-4H3/t20-,21-,22-/m0/s1 |
| InChIKey | PMCSWDQLQBISJV-FKBYEOEOSA-N |
| XLogP | 4.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate?
The IUPAC name of ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate (CID 101096071) is ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate.
What is the SMILES notation for ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate?
The canonical SMILES for ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate is CCOC(=O)[C@@H](CCC=C(C)C)[C@@H]1CC[C@H](OCc2ccc(OC)cc2)CO1.
What is the InChIKey of ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate?
The InChIKey is PMCSWDQLQBISJV-FKBYEOEOSA-N. The full InChI is InChI=1S/C23H34O5/c1-5-26-23(24)21(8-6-7-17(2)3)22-14-13-20(16-28-22)27-15-18-9-11-19(25-4)12-10-18/h7,9-12,20-22H,5-6,8,13-16H2,1-4H3/t20-,21-,22-/m0/s1.
What are the key properties of ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate?
ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate has a molecular weight of 390.52 g/mol, XLogP of 4.69, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[(2S,5S)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]-6-methylhept-5-enoate is sourced from PubChem (CID 101096071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).