About (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one
(5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (PubChem CID 101096415) has the molecular formula C6H5BrO3
and a molecular weight of 205.01 g/mol. Its IUPAC name is (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
Molecular Properties
| Compound Name | (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| PubChem CID | 101096415 |
| Molecular Formula | C6H5BrO3 |
| Molecular Weight | 205.01 g/mol |
| Exact Mass | 203.94 |
| IUPAC Name | (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one |
| SMILES | O=C1C(Br)=CC2CO[C@@H]1O2 |
| InChI | InChI=1S/C6H5BrO3/c7-4-1-3-2-9-6(10-3)5(4)8/h1,3,6H,2H2/t3?,6-/m1/s1 |
| InChIKey | NNMLLZVMSJKNIZ-PUOGSPQQSA-N |
| XLogP | 0.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.01 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The IUPAC name of (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one (CID 101096415) is (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one.
What is the SMILES notation for (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The canonical SMILES for (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is O=C1C(Br)=CC2CO[C@@H]1O2.
What is the InChIKey of (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
The InChIKey is NNMLLZVMSJKNIZ-PUOGSPQQSA-N. The full InChI is InChI=1S/C6H5BrO3/c7-4-1-3-2-9-6(10-3)5(4)8/h1,3,6H,2H2/t3?,6-/m1/s1.
What are the key properties of (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one?
(5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one has a molecular weight of 205.01 g/mol, XLogP of 0.59, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-3-bromo-6,8-dioxabicyclo[3.2.1]oct-2-en-4-one is sourced from PubChem (CID 101096415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).