About S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate
S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate (PubChem CID 101096450) has the molecular formula C14H15NOS
and a molecular weight of 245.35 g/mol. Its IUPAC name is S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate.
Molecular Properties
| Compound Name | S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate |
| PubChem CID | 101096450 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate |
| SMILES | Cc1ccc(SC(=O)/C=C/CCCC#N)cc1 |
| InChI | InChI=1S/C14H15NOS/c1-12-7-9-13(10-8-12)17-14(16)6-4-2-3-5-11-15/h4,6-10H,2-3,5H2,1H3/b6-4+ |
| InChIKey | UVEPAOYIQCRDGU-GQCTYLIASA-N |
| XLogP | 3.86 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate?
The IUPAC name of S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate (CID 101096450) is S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate.
What is the SMILES notation for S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate?
The canonical SMILES for S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate is Cc1ccc(SC(=O)/C=C/CCCC#N)cc1.
What is the InChIKey of S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate?
The InChIKey is UVEPAOYIQCRDGU-GQCTYLIASA-N. The full InChI is InChI=1S/C14H15NOS/c1-12-7-9-13(10-8-12)17-14(16)6-4-2-3-5-11-15/h4,6-10H,2-3,5H2,1H3/b6-4+.
What are the key properties of S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate?
S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate has a molecular weight of 245.35 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(4-methylphenyl) (E)-6-cyanohex-2-enethioate is sourced from PubChem (CID 101096450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).