About 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one
7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one (PubChem CID 101096711) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one.
Molecular Properties
| Compound Name | 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one |
| PubChem CID | 101096711 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one |
| SMILES | C=C1C(=O)C=C2CCCOC12 |
| InChI | InChI=1S/C9H10O2/c1-6-8(10)5-7-3-2-4-11-9(6)7/h5,9H,1-4H2 |
| InChIKey | IOXJQCFKIUDZBK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one?
The IUPAC name of 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one (CID 101096711) is 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one.
What is the SMILES notation for 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one?
The canonical SMILES for 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one is C=C1C(=O)C=C2CCCOC12.
What is the InChIKey of 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one?
The InChIKey is IOXJQCFKIUDZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-6-8(10)5-7-3-2-4-11-9(6)7/h5,9H,1-4H2.
What are the key properties of 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one?
7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one has a molecular weight of 150.18 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one is sourced from PubChem (CID 101096711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).