C10H12O2 — CID 101096712
(7Z)-7-ethylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one (PubChem CID 101096712) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (7Z)-7-ethylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one.
| Compound Name | (7Z)-7-ethylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one |
|---|---|
| PubChem CID | 101096712 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (7Z)-7-ethylidene-2,3,4,7a-tetrahydrocyclopenta[b]pyran-6-one |
| SMILES | C/C=C1\C(=O)C=C2CCCOC21 |
| InChI | InChI=1S/C10H12O2/c1-2-8-9(11)6-7-4-3-5-12-10(7)8/h2,6,10H,3-5H2,1H3/b8-2+ |
| InChIKey | PGQMPSAQKIYQIV-KRXBUXKQSA-N |
| XLogP | 1.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|