About 2-ethoxy-1,3-dimethylcyclohexane
2-ethoxy-1,3-dimethylcyclohexane (PubChem CID 101096771) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-ethoxy-1,3-dimethylcyclohexane.
Molecular Properties
| Compound Name | 2-ethoxy-1,3-dimethylcyclohexane |
| PubChem CID | 101096771 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 2-ethoxy-1,3-dimethylcyclohexane |
| SMILES | CCOC1C(C)CCCC1C |
| InChI | InChI=1S/C10H20O/c1-4-11-10-8(2)6-5-7-9(10)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | HMKOSXMYMMZQQM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethoxy-1,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-1,3-dimethylcyclohexane?
The IUPAC name of 2-ethoxy-1,3-dimethylcyclohexane (CID 101096771) is 2-ethoxy-1,3-dimethylcyclohexane.
What is the SMILES notation for 2-ethoxy-1,3-dimethylcyclohexane?
The canonical SMILES for 2-ethoxy-1,3-dimethylcyclohexane is CCOC1C(C)CCCC1C.
What is the InChIKey of 2-ethoxy-1,3-dimethylcyclohexane?
The InChIKey is HMKOSXMYMMZQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O/c1-4-11-10-8(2)6-5-7-9(10)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 2-ethoxy-1,3-dimethylcyclohexane?
2-ethoxy-1,3-dimethylcyclohexane has a molecular weight of 156.27 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-1,3-dimethylcyclohexane is sourced from PubChem (CID 101096771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).