C17H17BrF2O2 — CID 10109752
4-bromo-9a-butyl-6,8-difluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one (PubChem CID 10109752) has the molecular formula C17H17BrF2O2 and a molecular weight of 371.22 g/mol. Its IUPAC name is 4-bromo-9a-butyl-6,8-difluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one.
| Compound Name | 4-bromo-9a-butyl-6,8-difluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one |
|---|---|
| PubChem CID | 10109752 |
| Molecular Formula | C17H17BrF2O2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 4-bromo-9a-butyl-6,8-difluoro-7-hydroxy-2,9-dihydro-1H-fluoren-3-one |
| SMILES | CCCCC12CCC(=O)C(Br)=C1c1cc(F)c(O)c(F)c1C2 |
| InChI | InChI=1S/C17H17BrF2O2/c1-2-3-5-17-6-4-12(21)14(18)13(17)9-7-11(19)16(22)15(20)10(9)8-17/h7,22H,2-6,8H2,1H3 |
| InChIKey | JCPWQXOPIXORPF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|