C18H30O4 — CID 101097583
ethyl (1S,2S,4aR,6R,8aR)-2-(methoxymethoxymethyl)-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 101097583) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is ethyl (1S,2S,4aR,6R,8aR)-2-(methoxymethoxymethyl)-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | ethyl (1S,2S,4aR,6R,8aR)-2-(methoxymethoxymethyl)-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 101097583 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl (1S,2S,4aR,6R,8aR)-2-(methoxymethoxymethyl)-1,6-dimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)[C@@H](COCOC)C=C[C@H]2C[C@H](C)CC[C@H]21 |
| InChI | InChI=1S/C18H30O4/c1-5-22-17(19)18(3)15(11-21-12-20-4)8-7-14-10-13(2)6-9-16(14)18/h7-8,13-16H,5-6,9-12H2,1-4H3/t13-,14+,15-,16-,18-/m1/s1 |
| InChIKey | CCJCPMADOXDEST-ORDFZIBCSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|