C29H40O4Si — CID 101097657
tert-butyl-diphenyl-[2-(4,6,8-trioxadispiro[4.1.57.25]tetradecan-3-yl)ethoxy]silane (PubChem CID 101097657) has the molecular formula C29H40O4Si and a molecular weight of 480.72 g/mol. Its IUPAC name is tert-butyl-diphenyl-[2-(4,6,8-trioxadispiro[4.1.57.25]tetradecan-3-yl)ethoxy]silane.
| Compound Name | tert-butyl-diphenyl-[2-(4,6,8-trioxadispiro[4.1.57.25]tetradecan-3-yl)ethoxy]silane |
|---|---|
| PubChem CID | 101097657 |
| Molecular Formula | C29H40O4Si |
| Molecular Weight | 480.72 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | tert-butyl-diphenyl-[2-(4,6,8-trioxadispiro[4.1.57.25]tetradecan-3-yl)ethoxy]silane |
| SMILES | CC(C)(C)[Si](OCCC1CCC2(CCC3(CCCCO3)O2)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H40O4Si/c1-27(2,3)34(25-12-6-4-7-13-25,26-14-8-5-9-15-26)31-23-17-24-16-19-29(32-24)21-20-28(33-29)18-10-11-22-30-28/h4-9,12-15,24H,10-11,16-23H2,1-3H3 |
| InChIKey | KEPXMBIBDYJHDP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|