About 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one
7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one (PubChem CID 101097768) has the molecular formula C16H16N2O5S
and a molecular weight of 348.38 g/mol. Its IUPAC name is 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one |
| PubChem CID | 101097768 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one |
| SMILES | COc1cc(OC)nc(Sc2cccc3c2C(=O)OC3(C)OC)n1 |
| InChI | InChI=1S/C16H16N2O5S/c1-16(22-4)9-6-5-7-10(13(9)14(19)23-16)24-15-17-11(20-2)8-12(18-15)21-3/h5-8H,1-4H3 |
| InChIKey | PBVTXIFQIDYLOF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one?
The IUPAC name of 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one (CID 101097768) is 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one.
What is the SMILES notation for 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one?
The canonical SMILES for 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one is COc1cc(OC)nc(Sc2cccc3c2C(=O)OC3(C)OC)n1.
What is the InChIKey of 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one?
The InChIKey is PBVTXIFQIDYLOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O5S/c1-16(22-4)9-6-5-7-10(13(9)14(19)23-16)24-15-17-11(20-2)8-12(18-15)21-3/h5-8H,1-4H3.
What are the key properties of 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one?
7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one has a molecular weight of 348.38 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methoxy-3-methyl-2-benzofuran-1-one is sourced from PubChem (CID 101097768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).