C24H9F15O — CID 101097878
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-pyren-1-yloctan-1-one (PubChem CID 101097878) has the molecular formula C24H9F15O and a molecular weight of 598.31 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-pyren-1-yloctan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-pyren-1-yloctan-1-one |
|---|---|
| PubChem CID | 101097878 |
| Molecular Formula | C24H9F15O |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 598.04 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-1-pyren-1-yloctan-1-one |
| SMILES | O=C(c1ccc2ccc3cccc4ccc1c2c34)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H9F15O/c25-18(26,19(27,28)20(29,30)21(31,32)22(33,34)23(35,36)24(37,38)39)17(40)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | LVFMLZXLQFPOOH-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|