C21H30F3NO2 — CID 101097925
N-[(1S,2S)-1-[(3S,4R)-4-ethenyl-3-methylheptan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 101097925) has the molecular formula C21H30F3NO2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-[(1S,2S)-1-[(3S,4R)-4-ethenyl-3-methylheptan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(1S,2S)-1-[(3S,4R)-4-ethenyl-3-methylheptan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101097925 |
| Molecular Formula | C21H30F3NO2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-[(1S,2S)-1-[(3S,4R)-4-ethenyl-3-methylheptan-3-yl]oxy-1-phenylpropan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C=C[C@@H](CCC)[C@](C)(CC)O[C@@H](c1ccccc1)[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C21H30F3NO2/c1-6-12-17(7-2)20(5,8-3)27-18(16-13-10-9-11-14-16)15(4)25-19(26)21(22,23)24/h7,9-11,13-15,17-18H,2,6,8,12H2,1,3-5H3,(H,25,26)/t15-,17-,18+,20-/m0/s1 |
| InChIKey | XVLIAXBUGCZHBY-BOLBYERCSA-N |
| XLogP | 5.58 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|