C20H29NO — CID 101098058
(3S,6R,11S)-2,2,6,11-tetramethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene (PubChem CID 101098058) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (3S,6R,11S)-2,2,6,11-tetramethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene.
| Compound Name | (3S,6R,11S)-2,2,6,11-tetramethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene |
|---|---|
| PubChem CID | 101098058 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (3S,6R,11S)-2,2,6,11-tetramethyl-9-oxa-1-azatetracyclo[8.8.0.03,8.012,17]octadeca-12,14,16-triene |
| SMILES | C[C@@H]1CC[C@@H]2C(C1)OC1[C@@H](C)c3ccccc3CN1C2(C)C |
| InChI | InChI=1S/C20H29NO/c1-13-9-10-17-18(11-13)22-19-14(2)16-8-6-5-7-15(16)12-21(19)20(17,3)4/h5-8,13-14,17-19H,9-12H2,1-4H3/t13-,14+,17-,18?,19?/m1/s1 |
| InChIKey | DVDASVYKZWTKGK-RJSSVUDUSA-N |
| XLogP | 4.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |