C56H86Si4 — CID 101098365
[(3E,9E)-3,10-diethynyl-12-tri(propan-2-yl)silyl-4,9-bis[2-tri(propan-2-yl)silylethynyl]dodeca-3,9-dien-1,5,7,11-tetraynyl]-tri(propan-2-yl)silane (PubChem CID 101098365) has the molecular formula C56H86Si4 and a molecular weight of 871.65 g/mol. Its IUPAC name is [(3E,9E)-3,10-diethynyl-12-tri(propan-2-yl)silyl-4,9-bis[2-tri(propan-2-yl)silylethynyl]dodeca-3,9-dien-1,5,7,11-tetraynyl]-tri(propan-2-yl)silane.
| Compound Name | [(3E,9E)-3,10-diethynyl-12-tri(propan-2-yl)silyl-4,9-bis[2-tri(propan-2-yl)silylethynyl]dodeca-3,9-dien-1,5,7,11-tetraynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101098365 |
| Molecular Formula | C56H86Si4 |
| Molecular Weight | 871.65 g/mol |
| Exact Mass | 870.58 |
| IUPAC Name | [(3E,9E)-3,10-diethynyl-12-tri(propan-2-yl)silyl-4,9-bis[2-tri(propan-2-yl)silylethynyl]dodeca-3,9-dien-1,5,7,11-tetraynyl]-tri(propan-2-yl)silane |
| SMILES | C#C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(/C#CC#C/C(C#C[Si](C(C)C)(C(C)C)C(C)C)=C(/C#C)C#C[Si](C(C)C)(C(C)C)C(C)C)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C56H86Si4/c1-27-53(33-37-57(41(3)4,42(5)6)43(7)8)55(35-39-59(47(15)16,48(17)18)49(19)20)31-29-30-32-56(36-40-60(50(21)22,51(23)24)52(25)26)54(28-2)34-38-58(44(9)10,45(11)12)46(13)14/h1-2,41-52H,3-26H3/b55-53+,56-54+ |
| InChIKey | KZKFVVLZBGSUHS-DSZBTAPASA-N |
| XLogP | 15.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.65 |
| LogP ≤ 5 | 15.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|