C15H15FN2O — CID 101098379
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2,3-dihydropyridin-4-one (PubChem CID 101098379) has the molecular formula C15H15FN2O and a molecular weight of 258.30 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2,3-dihydropyridin-4-one.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 101098379 |
| Molecular Formula | C15H15FN2O |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2,3-dihydropyridin-4-one |
| SMILES | O=C1C=CN(CCc2c[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C15H15FN2O/c16-12-1-2-15-14(9-12)11(10-17-15)3-6-18-7-4-13(19)5-8-18/h1-2,4,7,9-10,17H,3,5-6,8H2 |
| InChIKey | ZWBTVIWHWZHNAN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |