About 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium
3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium (PubChem CID 101098827) has the molecular formula C6H13N2+
and a molecular weight of 113.18 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium.
Molecular Properties
| Compound Name | 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium |
| PubChem CID | 101098827 |
| Molecular Formula | C6H13N2+ |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.11 |
| IUPAC Name | 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium |
| SMILES | CCN1C=C[NH+](C)C1 |
| InChI | InChI=1S/C6H12N2/c1-3-8-5-4-7(2)6-8/h4-5H,3,6H2,1-2H3/p+1 |
| InChIKey | IBZJNLWLRUHZIX-UHFFFAOYSA-O |
| XLogP | -0.73 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium?
The IUPAC name of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium (CID 101098827) is 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium.
What is the SMILES notation for 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium?
The canonical SMILES for 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium is CCN1C=C[NH+](C)C1.
What is the InChIKey of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium?
The InChIKey is IBZJNLWLRUHZIX-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H12N2/c1-3-8-5-4-7(2)6-8/h4-5H,3,6H2,1-2H3/p+1.
What are the key properties of 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium?
3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium has a molecular weight of 113.18 g/mol, XLogP of -0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1-methyl-1,2-dihydroimidazol-1-ium is sourced from PubChem (CID 101098827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).