C15H21F3N2O2 — CID 101098862
(2R,4R)-5,5,5-trifluoro-4-hydroxy-2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]pentanenitrile (PubChem CID 101098862) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is (2R,4R)-5,5,5-trifluoro-4-hydroxy-2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]pentanenitrile.
| Compound Name | (2R,4R)-5,5,5-trifluoro-4-hydroxy-2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]pentanenitrile |
|---|---|
| PubChem CID | 101098862 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (2R,4R)-5,5,5-trifluoro-4-hydroxy-2-[[(1S,2S,5S)-2-hydroxy-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene]amino]pentanenitrile |
| SMILES | CC1(C)[C@@H]2C/C(=N\[C@@H](C#N)C[C@@H](O)C(F)(F)F)[C@@](C)(O)[C@H]1C2 |
| InChI | InChI=1S/C15H21F3N2O2/c1-13(2)8-4-10(13)14(3,22)11(5-8)20-9(7-19)6-12(21)15(16,17)18/h8-10,12,21-22H,4-6H2,1-3H3/b20-11+/t8-,9+,10-,12+,14-/m0/s1 |
| InChIKey | ZKGRPFPPNJAEBU-VZKRHECFSA-N |
| XLogP | 2.45 |
| TPSA | 76.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|