C24H24O6 — CID 101098867
[(2R,3S)-3-benzoyloxy-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methyl benzoate (PubChem CID 101098867) has the molecular formula C24H24O6 and a molecular weight of 408.45 g/mol. Its IUPAC name is [(2R,3S)-3-benzoyloxy-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methyl benzoate.
| Compound Name | [(2R,3S)-3-benzoyloxy-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 101098867 |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [(2R,3S)-3-benzoyloxy-6-[(E)-but-2-enoxy]-3,6-dihydro-2H-pyran-2-yl]methyl benzoate |
| SMILES | C/C=C/COC1C=C[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C24H24O6/c1-2-3-16-27-22-15-14-20(30-24(26)19-12-8-5-9-13-19)21(29-22)17-28-23(25)18-10-6-4-7-11-18/h2-15,20-22H,16-17H2,1H3/b3-2+/t20-,21+,22?/m0/s1 |
| InChIKey | KCYSXBWBXGJFHB-LJNXWXBHSA-N |
| XLogP | 3.94 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|