About [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone
[1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone (PubChem CID 10109902) has the molecular formula C24H27N3O
and a molecular weight of 373.50 g/mol. Its IUPAC name is [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone.
Molecular Properties
| Compound Name | [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone |
| PubChem CID | 10109902 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone |
| SMILES | Cc1ccc(-c2nc(C(=O)N3CCCCC3)n(C)c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H27N3O/c1-17-7-11-19(12-8-17)21-22(20-13-9-18(2)10-14-20)26(3)23(25-21)24(28)27-15-5-4-6-16-27/h7-14H,4-6,15-16H2,1-3H3 |
| InChIKey | ODFUPIJXHKDJJI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone?
The IUPAC name of [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone (CID 10109902) is [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone.
What is the SMILES notation for [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone?
The canonical SMILES for [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone is Cc1ccc(-c2nc(C(=O)N3CCCCC3)n(C)c2-c2ccc(C)cc2)cc1.
What is the InChIKey of [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone?
The InChIKey is ODFUPIJXHKDJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O/c1-17-7-11-19(12-8-17)21-22(20-13-9-18(2)10-14-20)26(3)23(25-21)24(28)27-15-5-4-6-16-27/h7-14H,4-6,15-16H2,1-3H3.
What are the key properties of [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone?
[1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone has a molecular weight of 373.50 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-methyl-4,5-bis(4-methylphenyl)imidazol-2-yl]-piperidin-1-ylmethanone is sourced from PubChem (CID 10109902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).