C16H26O8 — CID 101099257
ethyl (1R,2R,3R,4R,6R)-2-acetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxycyclohexane-1-carboxylate (PubChem CID 101099257) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is ethyl (1R,2R,3R,4R,6R)-2-acetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3R,4R,6R)-2-acetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101099257 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl (1R,2R,3R,4R,6R)-2-acetyloxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]([C@H]2COC(C)(C)O2)C[C@@H](O)[C@@H](O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H26O8/c1-5-21-15(20)12-9(11-7-22-16(3,4)24-11)6-10(18)13(19)14(12)23-8(2)17/h9-14,18-19H,5-7H2,1-4H3/t9-,10+,11+,12+,13+,14+/m0/s1 |
| InChIKey | FWTCJQMKBXMRSN-YHBOFVJASA-N |
| XLogP | -0.01 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |