C20H23FN2O2S — CID 10109955
(5aR,10bS)-3-ethyl-9-(4-fluorophenyl)sulfonyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole (PubChem CID 10109955) has the molecular formula C20H23FN2O2S and a molecular weight of 374.48 g/mol. Its IUPAC name is (5aR,10bS)-3-ethyl-9-(4-fluorophenyl)sulfonyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole.
| Compound Name | (5aR,10bS)-3-ethyl-9-(4-fluorophenyl)sulfonyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole |
|---|---|
| PubChem CID | 10109955 |
| Molecular Formula | C20H23FN2O2S |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (5aR,10bS)-3-ethyl-9-(4-fluorophenyl)sulfonyl-2,4,5,5a,6,10b-hexahydro-1H-azepino[4,5-b]indole |
| SMILES | CCN1CC[C@H]2Nc3ccc(S(=O)(=O)c4ccc(F)cc4)cc3[C@@H]2CC1 |
| InChI | InChI=1S/C20H23FN2O2S/c1-2-23-11-9-17-18-13-16(7-8-19(18)22-20(17)10-12-23)26(24,25)15-5-3-14(21)4-6-15/h3-8,13,17,20,22H,2,9-12H2,1H3/t17-,20+/m0/s1 |
| InChIKey | KJFWISZWGWNGIM-FXAWDEMLSA-N |
| XLogP | 3.65 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |