About 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol
2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol (PubChem CID 101099598) has the molecular formula C20H34N2O
and a molecular weight of 318.51 g/mol. Its IUPAC name is 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol |
| PubChem CID | 101099598 |
| Molecular Formula | C20H34N2O |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.27 |
| IUPAC Name | 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(N[C@@H]2CCCC[C@H]2N)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H34N2O/c1-19(2,3)13-11-14(20(4,5)6)18(23)17(12-13)22-16-10-8-7-9-15(16)21/h11-12,15-16,22-23H,7-10,21H2,1-6H3/t15-,16-/m1/s1 |
| InChIKey | HEAPNEHHGYLQLQ-HZPDHXFCSA-N |
| XLogP | 4.67 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol?
The IUPAC name of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol (CID 101099598) is 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol.
What is the SMILES notation for 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol?
The canonical SMILES for 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol is CC(C)(C)c1cc(N[C@@H]2CCCC[C@H]2N)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol?
The InChIKey is HEAPNEHHGYLQLQ-HZPDHXFCSA-N. The full InChI is InChI=1S/C20H34N2O/c1-19(2,3)13-11-14(20(4,5)6)18(23)17(12-13)22-16-10-8-7-9-15(16)21/h11-12,15-16,22-23H,7-10,21H2,1-6H3/t15-,16-/m1/s1.
What are the key properties of 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol?
2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol has a molecular weight of 318.51 g/mol, XLogP of 4.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(1R,2R)-2-aminocyclohexyl]amino]-4,6-ditert-butylphenol is sourced from PubChem (CID 101099598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).