C10H11Cl7 — CID 101100157
(2S,3S,5S,6S)-2,3,5,6-tetrachloro-1-(chloromethyl)-7-(dichloromethyl)-7-methylbicyclo[2.2.1]heptane (PubChem CID 101100157) has the molecular formula C10H11Cl7 and a molecular weight of 379.37 g/mol. Its IUPAC name is (2S,3S,5S,6S)-2,3,5,6-tetrachloro-1-(chloromethyl)-7-(dichloromethyl)-7-methylbicyclo[2.2.1]heptane.
| Compound Name | (2S,3S,5S,6S)-2,3,5,6-tetrachloro-1-(chloromethyl)-7-(dichloromethyl)-7-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 101100157 |
| Molecular Formula | C10H11Cl7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 375.87 |
| IUPAC Name | (2S,3S,5S,6S)-2,3,5,6-tetrachloro-1-(chloromethyl)-7-(dichloromethyl)-7-methylbicyclo[2.2.1]heptane |
| SMILES | CC1(C(Cl)Cl)C2[C@H](Cl)[C@@H](Cl)C1(CCl)[C@H](Cl)[C@H]2Cl |
| InChI | InChI=1S/C10H11Cl7/c1-9(8(16)17)3-4(12)6(14)10(9,2-11)7(15)5(3)13/h3-8H,2H2,1H3/t3?,4-,5-,6+,7+,9?,10?/m0/s1 |
| InChIKey | SDCXLLCDYMPYTJ-KGWZEDDPSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|