About CID 101100200
CID 101100200 (PubChem CID 101100200) has the molecular formula C5H4O2P-
and a molecular weight of 127.06 g/mol.
Molecular Properties
| Compound Name | CID 101100200 |
| PubChem CID | 101100200 |
| Molecular Formula | C5H4O2P- |
| Molecular Weight | 127.06 g/mol |
| Exact Mass | 127.00 |
| IUPAC Name | — |
| SMILES | C1=CC2=C[CH-]OP2O1 |
| InChI | InChI=1S/C5H4O2P/c1-3-6-8-5(1)2-4-7-8/h1-4H/q-1 |
| InChIKey | RIFMJYWNAVHWJA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.06 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 101100200 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101100200?
The IUPAC name of CID 101100200 (CID 101100200) is not available.
What is the SMILES notation for CID 101100200?
The canonical SMILES for CID 101100200 is C1=CC2=C[CH-]OP2O1.
What is the InChIKey of CID 101100200?
The InChIKey is RIFMJYWNAVHWJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O2P/c1-3-6-8-5(1)2-4-7-8/h1-4H/q-1.
What are the key properties of CID 101100200?
CID 101100200 has a molecular weight of 127.06 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101100200 is sourced from PubChem (CID 101100200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).