C10H11ClF2O4 — CID 101100330
ethyl 5-[chloro(difluoro)methyl]-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate (PubChem CID 101100330) has the molecular formula C10H11ClF2O4 and a molecular weight of 268.64 g/mol. Its IUPAC name is ethyl 5-[chloro(difluoro)methyl]-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate.
| Compound Name | ethyl 5-[chloro(difluoro)methyl]-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
|---|---|
| PubChem CID | 101100330 |
| Molecular Formula | C10H11ClF2O4 |
| Molecular Weight | 268.64 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | ethyl 5-[chloro(difluoro)methyl]-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C(F)(F)Cl)OC2OCCC12 |
| InChI | InChI=1S/C10H11ClF2O4/c1-2-15-8(14)6-5-3-4-16-9(5)17-7(6)10(11,12)13/h5,9H,2-4H2,1H3 |
| InChIKey | GZLJNTJCIILDMV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.64 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|