About (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one
(4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one (PubChem CID 101100665) has the molecular formula C15H22O5
and a molecular weight of 282.34 g/mol. Its IUPAC name is (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one |
| PubChem CID | 101100665 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one |
| SMILES | CCC(C)C(=O)[C@@H]1C(OC)=C(C)C(=O)[C@@]1(OC)C(C)=O |
| InChI | InChI=1S/C15H22O5/c1-7-8(2)12(17)11-13(19-5)9(3)14(18)15(11,20-6)10(4)16/h8,11H,7H2,1-6H3/t8?,11-,15-/m1/s1 |
| InChIKey | MZTWYWVCDNKYDG-KMYHTVOCSA-N |
| XLogP | 1.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one?
The IUPAC name of (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one (CID 101100665) is (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one.
What is the SMILES notation for (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one?
The canonical SMILES for (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one is CCC(C)C(=O)[C@@H]1C(OC)=C(C)C(=O)[C@@]1(OC)C(C)=O.
What is the InChIKey of (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one?
The InChIKey is MZTWYWVCDNKYDG-KMYHTVOCSA-N. The full InChI is InChI=1S/C15H22O5/c1-7-8(2)12(17)11-13(19-5)9(3)14(18)15(11,20-6)10(4)16/h8,11H,7H2,1-6H3/t8?,11-,15-/m1/s1.
What are the key properties of (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one?
(4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one has a molecular weight of 282.34 g/mol, XLogP of 1.70, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-5-acetyl-3,5-dimethoxy-2-methyl-4-(2-methylbutanoyl)cyclopent-2-en-1-one is sourced from PubChem (CID 101100665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).