About 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one
2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one (PubChem CID 10110067) has the molecular formula C23H24N2O3
and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
| PubChem CID | 10110067 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
| SMILES | COc1ccc(-c2cc(=O)n(C3CCCC3)nc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-27-19-11-7-16(8-12-19)21-15-22(26)25(18-5-3-4-6-18)24-23(21)17-9-13-20(28-2)14-10-17/h7-15,18H,3-6H2,1-2H3 |
| InChIKey | PAQFYSIVYBERJR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
The IUPAC name of 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one (CID 10110067) is 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one.
What is the SMILES notation for 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
The canonical SMILES for 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one is COc1ccc(-c2cc(=O)n(C3CCCC3)nc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
The InChIKey is PAQFYSIVYBERJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24N2O3/c1-27-19-11-7-16(8-12-19)21-15-22(26)25(18-5-3-4-6-18)24-23(21)17-9-13-20(28-2)14-10-17/h7-15,18H,3-6H2,1-2H3.
What are the key properties of 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one has a molecular weight of 376.46 g/mol, XLogP of 4.71, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-5,6-bis(4-methoxyphenyl)pyridazin-3-one is sourced from PubChem (CID 10110067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).