C19H18N3OS2+ — CID 101101561
N-[3-methyl-2-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-5-yl]acetamide (PubChem CID 101101561) has the molecular formula C19H18N3OS2+ and a molecular weight of 368.51 g/mol. Its IUPAC name is N-[3-methyl-2-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-5-yl]acetamide.
| Compound Name | N-[3-methyl-2-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-5-yl]acetamide |
|---|---|
| PubChem CID | 101101561 |
| Molecular Formula | C19H18N3OS2+ |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[3-methyl-2-[(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1,3-benzothiazol-3-ium-5-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)=[N+](C)C(C=C1Sc3ccccc3N1C)=S=2 |
| InChI | InChI=1S/C19H17N3OS2/c1-12(23)20-13-8-9-17-15(10-13)22(3)19(25-17)11-18-21(2)14-6-4-5-7-16(14)24-18/h4-11H,1-3H3/p+1 |
| InChIKey | RSECDEATPGBUCI-UHFFFAOYSA-O |
| XLogP | 2.98 |
| TPSA | 35.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|