C20H24N+ — CID 10110164
5-ethyl-1,2-dimethyl-4,4-diphenyl-2,3-dihydropyrrol-1-ium (PubChem CID 10110164) has the molecular formula C20H24N+ and a molecular weight of 278.42 g/mol. Its IUPAC name is 5-ethyl-1,2-dimethyl-4,4-diphenyl-2,3-dihydropyrrol-1-ium.
| Compound Name | 5-ethyl-1,2-dimethyl-4,4-diphenyl-2,3-dihydropyrrol-1-ium |
|---|---|
| PubChem CID | 10110164 |
| Molecular Formula | C20H24N+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 5-ethyl-1,2-dimethyl-4,4-diphenyl-2,3-dihydropyrrol-1-ium |
| SMILES | CCC1=[N+](C)C(C)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N/c1-4-19-20(15-16(2)21(19)3,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16H,4,15H2,1-3H3/q+1 |
| InChIKey | SCIYBRNSSXZMKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|