C22H28N2O — CID 101101842
1-[(1R,2S,3S,5S)-3-[4-(1,5-dimethylpyrrol-2-yl)phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one (PubChem CID 101101842) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(1R,2S,3S,5S)-3-[4-(1,5-dimethylpyrrol-2-yl)phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one.
| Compound Name | 1-[(1R,2S,3S,5S)-3-[4-(1,5-dimethylpyrrol-2-yl)phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one |
|---|---|
| PubChem CID | 101101842 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[(1R,2S,3S,5S)-3-[4-(1,5-dimethylpyrrol-2-yl)phenyl]-8-azabicyclo[3.2.1]octan-2-yl]propan-1-one |
| SMILES | CCC(=O)[C@H]1[C@@H](c2ccc(-c3ccc(C)n3C)cc2)C[C@@H]2CC[C@H]1N2 |
| InChI | InChI=1S/C22H28N2O/c1-4-21(25)22-18(13-17-10-11-19(22)23-17)15-6-8-16(9-7-15)20-12-5-14(2)24(20)3/h5-9,12,17-19,22-23H,4,10-11,13H2,1-3H3/t17-,18+,19+,22-/m0/s1 |
| InChIKey | XOWYBHZWCWBQKP-JYLXEMOASA-N |
| XLogP | 4.20 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|