About (3R)-tricyclo[2.2.1.02,6]heptan-3-amine
(3R)-tricyclo[2.2.1.02,6]heptan-3-amine (PubChem CID 101101886) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is (3R)-tricyclo[2.2.1.02,6]heptan-3-amine.
Molecular Properties
| Compound Name | (3R)-tricyclo[2.2.1.02,6]heptan-3-amine |
| PubChem CID | 101101886 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (3R)-tricyclo[2.2.1.02,6]heptan-3-amine |
| SMILES | N[C@@H]1C2CC3C(C2)C31 |
| InChI | InChI=1S/C7H11N/c8-7-3-1-4-5(2-3)6(4)7/h3-7H,1-2,8H2/t3?,4?,5?,6?,7-/m1/s1 |
| InChIKey | LQOHITYZFHUZFZ-SYRNTQKJSA-N |
| XLogP | 0.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3R)-tricyclo[2.2.1.02,6]heptan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-tricyclo[2.2.1.02,6]heptan-3-amine?
The IUPAC name of (3R)-tricyclo[2.2.1.02,6]heptan-3-amine (CID 101101886) is (3R)-tricyclo[2.2.1.02,6]heptan-3-amine.
What is the SMILES notation for (3R)-tricyclo[2.2.1.02,6]heptan-3-amine?
The canonical SMILES for (3R)-tricyclo[2.2.1.02,6]heptan-3-amine is N[C@@H]1C2CC3C(C2)C31.
What is the InChIKey of (3R)-tricyclo[2.2.1.02,6]heptan-3-amine?
The InChIKey is LQOHITYZFHUZFZ-SYRNTQKJSA-N. The full InChI is InChI=1S/C7H11N/c8-7-3-1-4-5(2-3)6(4)7/h3-7H,1-2,8H2/t3?,4?,5?,6?,7-/m1/s1.
What are the key properties of (3R)-tricyclo[2.2.1.02,6]heptan-3-amine?
(3R)-tricyclo[2.2.1.02,6]heptan-3-amine has a molecular weight of 109.17 g/mol, XLogP of 0.60, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-tricyclo[2.2.1.02,6]heptan-3-amine is sourced from PubChem (CID 101101886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).