C7H11N — CID 101101886
(3R)-tricyclo[2.2.1.02,6]heptan-3-amine (PubChem CID 101101886) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is (3R)-tricyclo[2.2.1.02,6]heptan-3-amine.
| Compound Name | (3R)-tricyclo[2.2.1.02,6]heptan-3-amine |
|---|---|
| PubChem CID | 101101886 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (3R)-tricyclo[2.2.1.02,6]heptan-3-amine |
| SMILES | N[C@@H]1C2CC3C(C2)C31 |
| InChI | InChI=1S/C7H11N/c8-7-3-1-4-5(2-3)6(4)7/h3-7H,1-2,8H2/t3?,4?,5?,6?,7-/m1/s1 |
| InChIKey | LQOHITYZFHUZFZ-SYRNTQKJSA-N |
| XLogP | 0.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |