C24H15Br2N — CID 101102074
(8S,15R)-8,15-dibromo-22-methylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene-1-carbonitrile (PubChem CID 101102074) has the molecular formula C24H15Br2N and a molecular weight of 477.20 g/mol. Its IUPAC name is (8S,15R)-8,15-dibromo-22-methylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene-1-carbonitrile.
| Compound Name | (8S,15R)-8,15-dibromo-22-methylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene-1-carbonitrile |
|---|---|
| PubChem CID | 101102074 |
| Molecular Formula | C24H15Br2N |
| Molecular Weight | 477.20 g/mol |
| Exact Mass | 474.96 |
| IUPAC Name | (8S,15R)-8,15-dibromo-22-methylhexacyclo[13.6.1.02,7.08,22.09,14.016,21]docosa-2,4,6,9,11,13,16,18,20-nonaene-1-carbonitrile |
| SMILES | CC12C3(C#N)c4ccccc4[C@@]1(Br)c1ccccc1[C@@]2(Br)c1ccccc13 |
| InChI | InChI=1S/C24H15Br2N/c1-21-22(14-27)15-8-2-4-10-17(15)23(21,25)19-12-6-7-13-20(19)24(21,26)18-11-5-3-9-16(18)22/h2-13H,1H3/t21?,22?,23-,24+ |
| InChIKey | WIOJMDFGTYBTIJ-ULBZPVTCSA-N |
| XLogP | 6.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.20 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|