C62H109Br — CID 101102208
1-(4-bromophenyl)-2,3,4,5,6-pentakis(3,7-dimethyloctyl)benzene (PubChem CID 101102208) has the molecular formula C62H109Br and a molecular weight of 934.46 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,3,4,5,6-pentakis(3,7-dimethyloctyl)benzene.
| Compound Name | 1-(4-bromophenyl)-2,3,4,5,6-pentakis(3,7-dimethyloctyl)benzene |
|---|---|
| PubChem CID | 101102208 |
| Molecular Formula | C62H109Br |
| Molecular Weight | 934.46 g/mol |
| Exact Mass | 932.77 |
| IUPAC Name | 1-(4-bromophenyl)-2,3,4,5,6-pentakis(3,7-dimethyloctyl)benzene |
| SMILES | CC(C)CCCC(C)CCc1c(CCC(C)CCCC(C)C)c(CCC(C)CCCC(C)C)c(-c2ccc(Br)cc2)c(CCC(C)CCCC(C)C)c1CCC(C)CCCC(C)C |
| InChI | InChI=1S/C62H109Br/c1-45(2)21-16-26-50(11)31-40-57-58(41-32-51(12)27-17-22-46(3)4)60(43-34-53(14)29-19-24-48(7)8)62(55-36-38-56(63)39-37-55)61(44-35-54(15)30-20-25-49(9)10)59(57)42-33-52(13)28-18-23-47(5)6/h36-39,45-54H,16-35,40-44H2,1-15H3 |
| InChIKey | MCFYMUCBFPTWQJ-UHFFFAOYSA-N |
| XLogP | 21.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 36 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.46 |
| LogP ≤ 5 | 21.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |