C18H23N3O4S — CID 101102357
5-[2-[1-(2,3-dihydroxypropyl)-4-pyridinylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 101102357) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 5-[2-[1-(2,3-dihydroxypropyl)-4-pyridinylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[2-[1-(2,3-dihydroxypropyl)-4-pyridinylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 101102357 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 5-[2-[1-(2,3-dihydroxypropyl)-4-pyridinylidene]ethylidene]-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(=CC=C2C=CN(CC(O)CO)C=C2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C18H23N3O4S/c1-3-20-16(24)15(17(25)21(4-2)18(20)26)6-5-13-7-9-19(10-8-13)11-14(23)12-22/h5-10,14,22-23H,3-4,11-12H2,1-2H3 |
| InChIKey | PQHYJHODTLVAAH-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|