About (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate
(3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 101102620) has the molecular formula C16H14O4
and a molecular weight of 270.28 g/mol. Its IUPAC name is (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
| PubChem CID | 101102620 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)Oc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C16H14O4/c1-19-14-8-5-12(6-9-14)7-10-16(18)20-15-4-2-3-13(17)11-15/h2-11,17H,1H3/b10-7+ |
| InChIKey | LZBHDYYRFCYCHQ-JXMROGBWSA-N |
| XLogP | 3.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
The IUPAC name of (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate (CID 101102620) is (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate.
What is the SMILES notation for (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
The canonical SMILES for (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate is COc1ccc(/C=C/C(=O)Oc2cccc(O)c2)cc1.
What is the InChIKey of (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
The InChIKey is LZBHDYYRFCYCHQ-JXMROGBWSA-N. The full InChI is InChI=1S/C16H14O4/c1-19-14-8-5-12(6-9-14)7-10-16(18)20-15-4-2-3-13(17)11-15/h2-11,17H,1H3/b10-7+.
What are the key properties of (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate?
(3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate has a molecular weight of 270.28 g/mol, XLogP of 3.02, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl) (E)-3-(4-methoxyphenyl)prop-2-enoate is sourced from PubChem (CID 101102620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).