C20H26S2 — CID 101102622
1,2-bis(4-propylphenyl)ethane-1,2-dithiol (PubChem CID 101102622) has the molecular formula C20H26S2 and a molecular weight of 330.56 g/mol. Its IUPAC name is 1,2-bis(4-propylphenyl)ethane-1,2-dithiol.
| Compound Name | 1,2-bis(4-propylphenyl)ethane-1,2-dithiol |
|---|---|
| PubChem CID | 101102622 |
| Molecular Formula | C20H26S2 |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 1,2-bis(4-propylphenyl)ethane-1,2-dithiol |
| SMILES | CCCc1ccc(C(S)C(S)c2ccc(CCC)cc2)cc1 |
| InChI | InChI=1S/C20H26S2/c1-3-5-15-7-11-17(12-8-15)19(21)20(22)18-13-9-16(6-4-2)10-14-18/h7-14,19-22H,3-6H2,1-2H3 |
| InChIKey | DTYFQQZEOIQFJE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|