C22H29N5O — CID 10110271
10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine (PubChem CID 10110271) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine.
| Compound Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
|---|---|
| PubChem CID | 10110271 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 10-(4-methoxy-2-methylphenyl)-11-methyl-N-pentan-3-yl-1,4,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-2,7,9,11-tetraen-2-amine |
| SMILES | CCC(CC)Nc1c2c(nc3c(-c4ccc(OC)cc4C)c(C)nn13)CCN2 |
| InChI | InChI=1S/C22H29N5O/c1-6-15(7-2)24-22-20-18(10-11-23-20)25-21-19(14(4)26-27(21)22)17-9-8-16(28-5)12-13(17)3/h8-9,12,15,23-24H,6-7,10-11H2,1-5H3 |
| InChIKey | KJFFHMOHMITGAG-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |