C24H33N3O — CID 10110274
3-[2-methyl-4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dipropylpropan-1-amine (PubChem CID 10110274) has the molecular formula C24H33N3O and a molecular weight of 379.55 g/mol. Its IUPAC name is 3-[2-methyl-4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dipropylpropan-1-amine.
| Compound Name | 3-[2-methyl-4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 10110274 |
| Molecular Formula | C24H33N3O |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | 3-[2-methyl-4-(8-methylimidazo[1,2-a]pyridin-2-yl)phenoxy]-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CCCOc1ccc(-c2cn3cccc(C)c3n2)cc1C |
| InChI | InChI=1S/C24H33N3O/c1-5-12-26(13-6-2)14-8-16-28-23-11-10-21(17-20(23)4)22-18-27-15-7-9-19(3)24(27)25-22/h7,9-11,15,17-18H,5-6,8,12-14,16H2,1-4H3 |
| InChIKey | KCHXEGFYEDQOTA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|